C19H24N2O2 — CID 111459728
N-[(3-hydroxycyclohexyl)methyl]-2,7-dimethylquinoline-3-carboxamide (PubChem CID 111459728) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-2,7-dimethylquinoline-3-carboxamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-2,7-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 111459728 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-2,7-dimethylquinoline-3-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCC3CCCC(O)C3)c(C)nc2c1 |
| InChI | InChI=1S/C19H24N2O2/c1-12-6-7-15-10-17(13(2)21-18(15)8-12)19(23)20-11-14-4-3-5-16(22)9-14/h6-8,10,14,16,22H,3-5,9,11H2,1-2H3,(H,20,23) |
| InChIKey | YOEUZXRSAHZMFO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |