C10H7Cl2IN2O2 — CID 164757848
ethyl 5,7-dichloro-3-iodo-1H-pyrrolo[2,3-c]pyridine-2-carboxylate (PubChem CID 164757848) has the molecular formula C10H7Cl2IN2O2 and a molecular weight of 384.99 g/mol. Its IUPAC name is ethyl 5,7-dichloro-3-iodo-1H-pyrrolo[2,3-c]pyridine-2-carboxylate.
| Compound Name | ethyl 5,7-dichloro-3-iodo-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 164757848 |
| Molecular Formula | C10H7Cl2IN2O2 |
| Molecular Weight | 384.99 g/mol |
| Exact Mass | 383.89 |
| IUPAC Name | ethyl 5,7-dichloro-3-iodo-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(Cl)nc(Cl)cc2c1I |
| InChI | InChI=1S/C10H7Cl2IN2O2/c1-2-17-10(16)8-6(13)4-3-5(11)14-9(12)7(4)15-8/h3,15H,2H2,1H3 |
| InChIKey | XAMSZOVCEQNSDB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|