C6H5ClINO2S — CID 170218980
ethyl 4-chloro-2-iodo-1,3-thiazole-5-carboxylate (PubChem CID 170218980) has the molecular formula C6H5ClINO2S and a molecular weight of 317.54 g/mol. Its IUPAC name is ethyl 4-chloro-2-iodo-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-chloro-2-iodo-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 170218980 |
| Molecular Formula | C6H5ClINO2S |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 316.88 |
| IUPAC Name | ethyl 4-chloro-2-iodo-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(I)nc1Cl |
| InChI | InChI=1S/C6H5ClINO2S/c1-2-11-5(10)3-4(7)9-6(8)12-3/h2H2,1H3 |
| InChIKey | PPFNUBJGNVSTKJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|