C10H12INO4S — CID 69484699
ethyl 4-(2-ethoxy-2-oxoethyl)-2-iodo-1,3-thiazole-5-carboxylate (PubChem CID 69484699) has the molecular formula C10H12INO4S and a molecular weight of 369.18 g/mol. Its IUPAC name is ethyl 4-(2-ethoxy-2-oxoethyl)-2-iodo-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-(2-ethoxy-2-oxoethyl)-2-iodo-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 69484699 |
| Molecular Formula | C10H12INO4S |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | ethyl 4-(2-ethoxy-2-oxoethyl)-2-iodo-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)Cc1nc(I)sc1C(=O)OCC |
| InChI | InChI=1S/C10H12INO4S/c1-3-15-7(13)5-6-8(9(14)16-4-2)17-10(11)12-6/h3-5H2,1-2H3 |
| InChIKey | PHCFGXUZSPQDCM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|