C17H20N4O5S — CID 100991597
ethyl 2-[(2-amino-5-methoxyphenyl)diazenyl]-4-(2-ethoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate (PubChem CID 100991597) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is ethyl 2-[(2-amino-5-methoxyphenyl)diazenyl]-4-(2-ethoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2-amino-5-methoxyphenyl)diazenyl]-4-(2-ethoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 100991597 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | ethyl 2-[(2-amino-5-methoxyphenyl)diazenyl]-4-(2-ethoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)Cc1nc(/N=N/c2cc(OC)ccc2N)sc1C(=O)OCC |
| InChI | InChI=1S/C17H20N4O5S/c1-4-25-14(22)9-13-15(16(23)26-5-2)27-17(19-13)21-20-12-8-10(24-3)6-7-11(12)18/h6-8H,4-5,9,18H2,1-3H3/b21-20+ |
| InChIKey | ZSGCBODRWNJDPC-QZQOTICOSA-N |
| XLogP | 3.43 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|