C10H17ClN4O2S — CID 18694344
ethyl 2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carboxylate;hydrochloride (PubChem CID 18694344) has the molecular formula C10H17ClN4O2S and a molecular weight of 292.79 g/mol. Its IUPAC name is ethyl 2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carboxylate;hydrochloride.
| Compound Name | ethyl 2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18694344 |
| Molecular Formula | C10H17ClN4O2S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | ethyl 2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carboxylate;hydrochloride |
| SMILES | CCCc1nc(N=C(N)N)sc1C(=O)OCC.Cl |
| InChI | InChI=1S/C10H16N4O2S.ClH/c1-3-5-6-7(8(15)16-4-2)17-10(13-6)14-9(11)12;/h3-5H2,1-2H3,(H4,11,12,13,14);1H |
| InChIKey | QRCVPJFZMMEDMF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|