C7H9BrN4OS — CID 59590154
2-[5-(2-bromoacetyl)-4-methyl-1,3-thiazol-2-yl]guanidine (PubChem CID 59590154) has the molecular formula C7H9BrN4OS and a molecular weight of 277.15 g/mol. Its IUPAC name is 2-[5-(2-bromoacetyl)-4-methyl-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[5-(2-bromoacetyl)-4-methyl-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 59590154 |
| Molecular Formula | C7H9BrN4OS |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 2-[5-(2-bromoacetyl)-4-methyl-1,3-thiazol-2-yl]guanidine |
| SMILES | Cc1nc(N=C(N)N)sc1C(=O)CBr |
| InChI | InChI=1S/C7H9BrN4OS/c1-3-5(4(13)2-8)14-7(11-3)12-6(9)10/h2H2,1H3,(H4,9,10,11,12) |
| InChIKey | KLYXEGBIEVKONZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|