C21H28N6O4S — CID 54119285
ethyl 3-[[2-[[2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoate (PubChem CID 54119285) has the molecular formula C21H28N6O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is ethyl 3-[[2-[[2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[2-[[2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 54119285 |
| Molecular Formula | C21H28N6O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | ethyl 3-[[2-[[2-(diaminomethylideneamino)-4-propyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoate |
| SMILES | CCCc1nc(N=C(N)N)sc1C(=O)NCC(=O)NC(CC(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C21H28N6O4S/c1-3-8-14-18(32-21(26-14)27-20(22)23)19(30)24-12-16(28)25-15(11-17(29)31-4-2)13-9-6-5-7-10-13/h5-7,9-10,15H,3-4,8,11-12H2,1-2H3,(H,24,30)(H,25,28)(H4,22,23,26,27) |
| InChIKey | NMMWGMPCIYJGME-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 161.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|