C22H22N6O4S — CID 18322975
3-[[2-[[2-(diaminomethylideneamino)-5-phenyl-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 18322975) has the molecular formula C22H22N6O4S and a molecular weight of 466.52 g/mol. Its IUPAC name is 3-[[2-[[2-(diaminomethylideneamino)-5-phenyl-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[2-[[2-(diaminomethylideneamino)-5-phenyl-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18322975 |
| Molecular Formula | C22H22N6O4S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-[[2-[[2-(diaminomethylideneamino)-5-phenyl-1,3-thiazole-4-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(N)=Nc1nc(C(=O)NCC(=O)NC(CC(=O)O)c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C22H22N6O4S/c23-21(24)28-22-27-18(19(33-22)14-9-5-2-6-10-14)20(32)25-12-16(29)26-15(11-17(30)31)13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,25,32)(H,26,29)(H,30,31)(H4,23,24,27,28) |
| InChIKey | OCBVDVUTJLPACH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 172.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|