C23H23N5O5S — CID 54209191
5-[3-[2-(diaminomethylideneamino)-4-methoxycarbonyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid (PubChem CID 54209191) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is 5-[3-[2-(diaminomethylideneamino)-4-methoxycarbonyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid.
| Compound Name | 5-[3-[2-(diaminomethylideneamino)-4-methoxycarbonyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 54209191 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 5-[3-[2-(diaminomethylideneamino)-4-methoxycarbonyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid |
| SMILES | COC(=O)c1nc(N=C(N)N)sc1-c1cccc(NC(=O)CC(CC(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H23N5O5S/c1-33-21(32)19-20(34-23(27-19)28-22(24)25)14-8-5-9-16(10-14)26-17(29)11-15(12-18(30)31)13-6-3-2-4-7-13/h2-10,15H,11-12H2,1H3,(H,26,29)(H,30,31)(H4,24,25,27,28) |
| InChIKey | PUSVPASEGGLYSH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 169.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|