C12H12ClN5O4S — CID 18323149
methyl 2-(diaminomethylideneamino)-5-(3-nitrophenyl)-1,3-thiazole-4-carboxylate;hydrochloride (PubChem CID 18323149) has the molecular formula C12H12ClN5O4S and a molecular weight of 357.78 g/mol. Its IUPAC name is methyl 2-(diaminomethylideneamino)-5-(3-nitrophenyl)-1,3-thiazole-4-carboxylate;hydrochloride.
| Compound Name | methyl 2-(diaminomethylideneamino)-5-(3-nitrophenyl)-1,3-thiazole-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18323149 |
| Molecular Formula | C12H12ClN5O4S |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | methyl 2-(diaminomethylideneamino)-5-(3-nitrophenyl)-1,3-thiazole-4-carboxylate;hydrochloride |
| SMILES | COC(=O)c1nc(N=C(N)N)sc1-c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C12H11N5O4S.ClH/c1-21-10(18)8-9(22-12(15-8)16-11(13)14)6-3-2-4-7(5-6)17(19)20;/h2-5H,1H3,(H4,13,14,15,16);1H |
| InChIKey | ZTBGQHIFGHSDIQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|