C22H22ClN5O3S — CID 18322849
5-[4-chloro-3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid (PubChem CID 18322849) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 5-[4-chloro-3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid.
| Compound Name | 5-[4-chloro-3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 18322849 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 5-[4-chloro-3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-3-phenylpentanoic acid |
| SMILES | Cc1nc(N=C(N)N)sc1-c1cc(NC(=O)CC(CC(=O)O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H22ClN5O3S/c1-12-20(32-22(26-12)28-21(24)25)16-11-15(7-8-17(16)23)27-18(29)9-14(10-19(30)31)13-5-3-2-4-6-13/h2-8,11,14H,9-10H2,1H3,(H,27,29)(H,30,31)(H4,24,25,26,28) |
| InChIKey | GLENENXTWPVYJQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|