C25H28N6O5S — CID 18323137
methyl 5-[3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 18323137) has the molecular formula C25H28N6O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is methyl 5-[3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl 5-[3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 18323137 |
| Molecular Formula | C25H28N6O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | methyl 5-[3-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazol-5-yl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)Nc1cccc(-c2sc(N=C(N)N)nc2C)c1 |
| InChI | InChI=1S/C25H28N6O5S/c1-15-21(37-24(28-15)31-23(26)27)17-9-6-10-18(13-17)29-22(33)19(11-12-20(32)35-2)30-25(34)36-14-16-7-4-3-5-8-16/h3-10,13,19H,11-12,14H2,1-2H3,(H,29,33)(H,30,34)(H4,26,27,28,31) |
| InChIKey | FTKXTSVTTHFNFH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 171.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|