C20H24N6O4S — CID 18322855
3-[[2-[cyclopropyl-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 18322855) has the molecular formula C20H24N6O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is 3-[[2-[cyclopropyl-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[2-[cyclopropyl-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18322855 |
| Molecular Formula | C20H24N6O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-[[2-[cyclopropyl-[2-(diaminomethylideneamino)-4-methyl-1,3-thiazole-5-carbonyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1nc(N=C(N)N)sc1C(=O)N(CC(=O)NC(CC(=O)O)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C20H24N6O4S/c1-11-17(31-20(23-11)25-19(21)22)18(30)26(13-7-8-13)10-15(27)24-14(9-16(28)29)12-5-3-2-4-6-12/h2-6,13-14H,7-10H2,1H3,(H,24,27)(H,28,29)(H4,21,22,23,25) |
| InChIKey | XVGBXCSFDUPSJN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 164.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|