C21H21N5O3S — CID 24642983
[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxo-1-phenylpropyl]urea (PubChem CID 24642983) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is [3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxo-1-phenylpropyl]urea.
| Compound Name | [3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxo-1-phenylpropyl]urea |
|---|---|
| PubChem CID | 24642983 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxo-1-phenylpropyl]urea |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)CC(NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C21H21N5O3S/c1-13-18(30-20(23-13)15-10-6-3-7-11-15)19(28)26-25-17(27)12-16(24-21(22)29)14-8-4-2-5-9-14/h2-11,16H,12H2,1H3,(H,25,27)(H,26,28)(H3,22,24,29) |
| InChIKey | IMHCFTTYWJBNCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|