C8H12N4O2S — CID 23545949
ethyl 2-(diaminomethylideneamino)-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 23545949) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is ethyl 2-(diaminomethylideneamino)-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(diaminomethylideneamino)-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 23545949 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | ethyl 2-(diaminomethylideneamino)-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N=C(N)N)sc1C |
| InChI | InChI=1S/C8H12N4O2S/c1-3-14-6(13)5-4(2)15-8(11-5)12-7(9)10/h3H2,1-2H3,(H4,9,10,11,12) |
| InChIKey | CZMMLVGNYHXMJY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|