C7H6Cl2N2O2 — CID 53419466
ethyl 3,5-dichloropyrazine-2-carboxylate (PubChem CID 53419466) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is ethyl 3,5-dichloropyrazine-2-carboxylate.
| Compound Name | ethyl 3,5-dichloropyrazine-2-carboxylate |
|---|---|
| PubChem CID | 53419466 |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | ethyl 3,5-dichloropyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(Cl)nc1Cl |
| InChI | InChI=1S/C7H6Cl2N2O2/c1-2-13-7(12)5-6(9)11-4(8)3-10-5/h3H,2H2,1H3 |
| InChIKey | WDQSZLFJRHJQGN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |