C9H2Cl4N4O — CID 174592625
bis(3,5-dichloropyrazin-2-yl)methanone (PubChem CID 174592625) has the molecular formula C9H2Cl4N4O and a molecular weight of 323.95 g/mol. Its IUPAC name is bis(3,5-dichloropyrazin-2-yl)methanone.
| Compound Name | bis(3,5-dichloropyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 174592625 |
| Molecular Formula | C9H2Cl4N4O |
| Molecular Weight | 323.95 g/mol |
| Exact Mass | 321.90 |
| IUPAC Name | bis(3,5-dichloropyrazin-2-yl)methanone |
| SMILES | O=C(c1ncc(Cl)nc1Cl)c1ncc(Cl)nc1Cl |
| InChI | InChI=1S/C9H2Cl4N4O/c10-3-1-14-5(8(12)16-3)7(18)6-9(13)17-4(11)2-15-6/h1-2H |
| InChIKey | KXHFTYRFVMNLBC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.95 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |