C9H11Cl2N3O — CID 135363122
(3S)-4-[(3,5-dichloropyrazin-2-yl)amino]-3-methylbutan-2-one (PubChem CID 135363122) has the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. Its IUPAC name is (3S)-4-[(3,5-dichloropyrazin-2-yl)amino]-3-methylbutan-2-one.
| Compound Name | (3S)-4-[(3,5-dichloropyrazin-2-yl)amino]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 135363122 |
| Molecular Formula | C9H11Cl2N3O |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | (3S)-4-[(3,5-dichloropyrazin-2-yl)amino]-3-methylbutan-2-one |
| SMILES | CC(=O)[C@@H](C)CNc1ncc(Cl)nc1Cl |
| InChI | InChI=1S/C9H11Cl2N3O/c1-5(6(2)15)3-12-9-8(11)14-7(10)4-13-9/h4-5H,3H2,1-2H3,(H,12,13)/t5-/m0/s1 |
| InChIKey | JZWDZCDQTAAHRZ-YFKPBYRVSA-N |
| XLogP | 2.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |