C6H6Cl2N4O — CID 139366075
N'-(3,5-dichloropyrazin-2-yl)acetohydrazide (PubChem CID 139366075) has the molecular formula C6H6Cl2N4O and a molecular weight of 221.05 g/mol. Its IUPAC name is N'-(3,5-dichloropyrazin-2-yl)acetohydrazide.
| Compound Name | N'-(3,5-dichloropyrazin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 139366075 |
| Molecular Formula | C6H6Cl2N4O |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | N'-(3,5-dichloropyrazin-2-yl)acetohydrazide |
| SMILES | CC(=O)NNc1ncc(Cl)nc1Cl |
| InChI | InChI=1S/C6H6Cl2N4O/c1-3(13)11-12-6-5(8)10-4(7)2-9-6/h2H,1H3,(H,9,12)(H,11,13) |
| InChIKey | DDYJMPOKPQLPNT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|