C6H4Cl3N3O — CID 166431692
2-chloro-N-(3,5-dichloropyrazin-2-yl)acetamide (PubChem CID 166431692) has the molecular formula C6H4Cl3N3O and a molecular weight of 240.48 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloropyrazin-2-yl)acetamide.
| Compound Name | 2-chloro-N-(3,5-dichloropyrazin-2-yl)acetamide |
|---|---|
| PubChem CID | 166431692 |
| Molecular Formula | C6H4Cl3N3O |
| Molecular Weight | 240.48 g/mol |
| Exact Mass | 238.94 |
| IUPAC Name | 2-chloro-N-(3,5-dichloropyrazin-2-yl)acetamide |
| SMILES | O=C(CCl)Nc1ncc(Cl)nc1Cl |
| InChI | InChI=1S/C6H4Cl3N3O/c7-1-4(13)12-6-5(9)11-3(8)2-10-6/h2H,1H2,(H,10,12,13) |
| InChIKey | ORUDWNJHZSTJHR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|