C8H8ClIN2O — CID 126993024
2-chloro-N-(5-iodo-3-methyl-2-pyridinyl)acetamide (PubChem CID 126993024) has the molecular formula C8H8ClIN2O and a molecular weight of 310.52 g/mol. Its IUPAC name is 2-chloro-N-(5-iodo-3-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-chloro-N-(5-iodo-3-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 126993024 |
| Molecular Formula | C8H8ClIN2O |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 2-chloro-N-(5-iodo-3-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1cc(I)cnc1NC(=O)CCl |
| InChI | InChI=1S/C8H8ClIN2O/c1-5-2-6(10)4-11-8(5)12-7(13)3-9/h2,4H,3H2,1H3,(H,11,12,13) |
| InChIKey | PFZRBRXCSLEMRF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|