C18H21IN2O2 — CID 39378744
2-[4-[(2S)-butan-2-yl]phenoxy]-N-(5-iodo-3-methyl-2-pyridinyl)acetamide (PubChem CID 39378744) has the molecular formula C18H21IN2O2 and a molecular weight of 424.28 g/mol. Its IUPAC name is 2-[4-[(2S)-butan-2-yl]phenoxy]-N-(5-iodo-3-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-[4-[(2S)-butan-2-yl]phenoxy]-N-(5-iodo-3-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 39378744 |
| Molecular Formula | C18H21IN2O2 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[4-[(2S)-butan-2-yl]phenoxy]-N-(5-iodo-3-methyl-2-pyridinyl)acetamide |
| SMILES | CC[C@H](C)c1ccc(OCC(=O)Nc2ncc(I)cc2C)cc1 |
| InChI | InChI=1S/C18H21IN2O2/c1-4-12(2)14-5-7-16(8-6-14)23-11-17(22)21-18-13(3)9-15(19)10-20-18/h5-10,12H,4,11H2,1-3H3,(H,20,21,22)/t12-/m0/s1 |
| InChIKey | DICISJNLXQZCNZ-LBPRGKRZSA-N |
| XLogP | 4.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|