C7H8ClN3O — CID 15149679
1-[(3-chloropyrazin-2-yl)amino]propan-2-one (PubChem CID 15149679) has the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. Its IUPAC name is 1-[(3-chloropyrazin-2-yl)amino]propan-2-one.
| Compound Name | 1-[(3-chloropyrazin-2-yl)amino]propan-2-one |
|---|---|
| PubChem CID | 15149679 |
| Molecular Formula | C7H8ClN3O |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 1-[(3-chloropyrazin-2-yl)amino]propan-2-one |
| SMILES | CC(=O)CNc1nccnc1Cl |
| InChI | InChI=1S/C7H8ClN3O/c1-5(12)4-11-7-6(8)9-2-3-10-7/h2-3H,4H2,1H3,(H,10,11) |
| InChIKey | MPXHDJBYJOJPEO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |