C9H12ClN3O — CID 142792962
5-chloro-3-ethyl-N,N-dimethylpyrazine-2-carboxamide (PubChem CID 142792962) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is 5-chloro-3-ethyl-N,N-dimethylpyrazine-2-carboxamide.
| Compound Name | 5-chloro-3-ethyl-N,N-dimethylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142792962 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 5-chloro-3-ethyl-N,N-dimethylpyrazine-2-carboxamide |
| SMILES | CCc1nc(Cl)cnc1C(=O)N(C)C |
| InChI | InChI=1S/C9H12ClN3O/c1-4-6-8(9(14)13(2)3)11-5-7(10)12-6/h5H,4H2,1-3H3 |
| InChIKey | FOBGOYPCRRPJSA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |