C8H8Cl2N4O2 — CID 151173932
ethyl 2-(3,5-dichloropyrazin-2-yl)-2-hydrazinylideneacetate (PubChem CID 151173932) has the molecular formula C8H8Cl2N4O2 and a molecular weight of 263.08 g/mol. Its IUPAC name is ethyl 2-(3,5-dichloropyrazin-2-yl)-2-hydrazinylideneacetate.
| Compound Name | ethyl 2-(3,5-dichloropyrazin-2-yl)-2-hydrazinylideneacetate |
|---|---|
| PubChem CID | 151173932 |
| Molecular Formula | C8H8Cl2N4O2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | ethyl 2-(3,5-dichloropyrazin-2-yl)-2-hydrazinylideneacetate |
| SMILES | CCOC(=O)C(=NN)c1ncc(Cl)nc1Cl |
| InChI | InChI=1S/C8H8Cl2N4O2/c1-2-16-8(15)6(14-11)5-7(10)13-4(9)3-12-5/h3H,2,11H2,1H3 |
| InChIKey | NCWDNNLGKMNRQX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|