About 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate
1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate (PubChem CID 145442850) has the molecular formula C15H15Cl3N2O2
and a molecular weight of 361.66 g/mol. Its IUPAC name is 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate.
Molecular Properties
| Compound Name | 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate |
| PubChem CID | 145442850 |
| Molecular Formula | C15H15Cl3N2O2 |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C)nc1Cl.Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H9ClN2O2.C7H6Cl2/c1-3-13-8(12)6-7(9)11-5(2)4-10-6;1-5-3-2-4-6(8)7(5)9/h4H,3H2,1-2H3;2-4H,1H3 |
| InChIKey | OGQBPMSVBROMHL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate?
The IUPAC name of 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate (CID 145442850) is 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate.
What is the SMILES notation for 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate?
The canonical SMILES for 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate is CCOC(=O)c1ncc(C)nc1Cl.Cc1cccc(Cl)c1Cl.
What is the InChIKey of 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate?
The InChIKey is OGQBPMSVBROMHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O2.C7H6Cl2/c1-3-13-8(12)6-7(9)11-5(2)4-10-6;1-5-3-2-4-6(8)7(5)9/h4H,3H2,1-2H3;2-4H,1H3.
What are the key properties of 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate?
1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate has a molecular weight of 361.66 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3-methylbenzene;ethyl 3-chloro-5-methylpyrazine-2-carboxylate is sourced from PubChem (CID 145442850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).