C9H7Cl2NO4 — CID 141464389
4,5-dichloro-2-ethoxycarbonylpyridine-3-carboxylic acid (PubChem CID 141464389) has the molecular formula C9H7Cl2NO4 and a molecular weight of 264.06 g/mol. Its IUPAC name is 4,5-dichloro-2-ethoxycarbonylpyridine-3-carboxylic acid.
| Compound Name | 4,5-dichloro-2-ethoxycarbonylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 141464389 |
| Molecular Formula | C9H7Cl2NO4 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 4,5-dichloro-2-ethoxycarbonylpyridine-3-carboxylic acid |
| SMILES | CCOC(=O)c1ncc(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C9H7Cl2NO4/c1-2-16-9(15)7-5(8(13)14)6(11)4(10)3-12-7/h3H,2H2,1H3,(H,13,14) |
| InChIKey | JOIGTIDNYXIURA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |