4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid

C8H5Cl2NO4 — CID 141464391

IUPAC4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid
SMILESCOC(=O)c1ncc(Cl)c(Cl)c1C(=O)O
InChIInChI=1S/C8H5Cl2NO4/c1-15-8(14)6-4(7(12)13)5(10)3(9)2-11-6/h2H,1H3,(H,12,13)
InChIKeyHJMSTWIRBNXGNP-UHFFFAOYSA-N
MW250.04 g/mol
LogP1.87
Rot. Bonds2

About 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid

4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid (PubChem CID 141464391) has the molecular formula C8H5Cl2NO4 and a molecular weight of 250.04 g/mol. Its IUPAC name is 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid
PubChem CID141464391
Molecular FormulaC8H5Cl2NO4
Molecular Weight250.04 g/mol
Exact Mass248.96
IUPAC Name4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid
SMILESCOC(=O)c1ncc(Cl)c(Cl)c1C(=O)O
InChIInChI=1S/C8H5Cl2NO4/c1-15-8(14)6-4(7(12)13)5(10)3(9)2-11-6/h2H,1H3,(H,12,13)
InChIKeyHJMSTWIRBNXGNP-UHFFFAOYSA-N
XLogP1.87
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.04
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid?
The IUPAC name of 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid (CID 141464391) is 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid.
What is the SMILES notation for 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid?
The canonical SMILES for 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid is COC(=O)c1ncc(Cl)c(Cl)c1C(=O)O.
What is the InChIKey of 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid?
The InChIKey is HJMSTWIRBNXGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2NO4/c1-15-8(14)6-4(7(12)13)5(10)3(9)2-11-6/h2H,1H3,(H,12,13).
What are the key properties of 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid?
4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid has a molecular weight of 250.04 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-methoxycarbonylpyridine-3-carboxylic acid is sourced from PubChem (CID 141464391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).