C6H6ClN3O2 — CID 118996637
methyl 6-amino-5-chloropyrimidine-4-carboxylate (PubChem CID 118996637) has the molecular formula C6H6ClN3O2 and a molecular weight of 187.59 g/mol. Its IUPAC name is methyl 6-amino-5-chloropyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-5-chloropyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 118996637 |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | methyl 6-amino-5-chloropyrimidine-4-carboxylate |
| SMILES | COC(=O)c1ncnc(N)c1Cl |
| InChI | InChI=1S/C6H6ClN3O2/c1-12-6(11)4-3(7)5(8)10-2-9-4/h2H,1H3,(H2,8,9,10) |
| InChIKey | HARXCRXKTDBLHQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |