C13H7Cl3FNO2 — CID 134636624
methyl 3-fluoro-5-(3,4,5-trichlorophenyl)pyridine-2-carboxylate (PubChem CID 134636624) has the molecular formula C13H7Cl3FNO2 and a molecular weight of 334.56 g/mol. Its IUPAC name is methyl 3-fluoro-5-(3,4,5-trichlorophenyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-fluoro-5-(3,4,5-trichlorophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134636624 |
| Molecular Formula | C13H7Cl3FNO2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | methyl 3-fluoro-5-(3,4,5-trichlorophenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(-c2cc(Cl)c(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C13H7Cl3FNO2/c1-20-13(19)12-10(17)4-7(5-18-12)6-2-8(14)11(16)9(15)3-6/h2-5H,1H3 |
| InChIKey | NJNKEQIPVFALJR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|