C19H9Cl6NO2 — CID 134636546
methyl 3,5-bis(2,4,6-trichlorophenyl)pyridine-2-carboxylate (PubChem CID 134636546) has the molecular formula C19H9Cl6NO2 and a molecular weight of 496.00 g/mol. Its IUPAC name is methyl 3,5-bis(2,4,6-trichlorophenyl)pyridine-2-carboxylate.
| Compound Name | methyl 3,5-bis(2,4,6-trichlorophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134636546 |
| Molecular Formula | C19H9Cl6NO2 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 492.88 |
| IUPAC Name | methyl 3,5-bis(2,4,6-trichlorophenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(-c2c(Cl)cc(Cl)cc2Cl)cc1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C19H9Cl6NO2/c1-28-19(27)18-11(17-14(24)5-10(21)6-15(17)25)2-8(7-26-18)16-12(22)3-9(20)4-13(16)23/h2-7H,1H3 |
| InChIKey | HOTAZJQIPRQKDT-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |