C14H8Cl3NO4 — CID 8961342
(4-methoxycarbonylphenyl) 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 8961342) has the molecular formula C14H8Cl3NO4 and a molecular weight of 360.58 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 8961342 |
| Molecular Formula | C14H8Cl3NO4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | (4-methoxycarbonylphenyl) 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2ncc(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C14H8Cl3NO4/c1-21-13(19)7-2-4-8(5-3-7)22-14(20)12-11(17)10(16)9(15)6-18-12/h2-6H,1H3 |
| InChIKey | KHXNDXWFBKQSSA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|