C15H10Cl3NO4 — CID 16551449
(4-acetyl-2-methoxyphenyl) 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 16551449) has the molecular formula C15H10Cl3NO4 and a molecular weight of 374.61 g/mol. Its IUPAC name is (4-acetyl-2-methoxyphenyl) 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | (4-acetyl-2-methoxyphenyl) 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 16551449 |
| Molecular Formula | C15H10Cl3NO4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | (4-acetyl-2-methoxyphenyl) 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | COc1cc(C(C)=O)ccc1OC(=O)c1ncc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl3NO4/c1-7(20)8-3-4-10(11(5-8)22-2)23-15(21)14-13(18)12(17)9(16)6-19-14/h3-6H,1-2H3 |
| InChIKey | MBXINRMJOFZYFD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|