C15H12Cl3NO4 — CID 167892651
2-(4-methoxyphenoxy)ethyl 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 167892651) has the molecular formula C15H12Cl3NO4 and a molecular weight of 376.62 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 167892651 |
| Molecular Formula | C15H12Cl3NO4 |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | COc1ccc(OCCOC(=O)c2ncc(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl3NO4/c1-21-9-2-4-10(5-3-9)22-6-7-23-15(20)14-13(18)12(17)11(16)8-19-14/h2-5,8H,6-7H2,1H3 |
| InChIKey | HNJRESXIHLOMTD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|