C20H23NO2S2 — CID 58873150
ethyl 3-(4-tert-butylphenyl)-5-ethylsulfanyl-4-isocyanothiophene-2-carboxylate (PubChem CID 58873150) has the molecular formula C20H23NO2S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is ethyl 3-(4-tert-butylphenyl)-5-ethylsulfanyl-4-isocyanothiophene-2-carboxylate.
| Compound Name | ethyl 3-(4-tert-butylphenyl)-5-ethylsulfanyl-4-isocyanothiophene-2-carboxylate |
|---|---|
| PubChem CID | 58873150 |
| Molecular Formula | C20H23NO2S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | ethyl 3-(4-tert-butylphenyl)-5-ethylsulfanyl-4-isocyanothiophene-2-carboxylate |
| SMILES | [C-]#[N+]c1c(SCC)sc(C(=O)OCC)c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H23NO2S2/c1-7-23-18(22)17-15(16(21-6)19(25-17)24-8-2)13-9-11-14(12-10-13)20(3,4)5/h9-12H,7-8H2,1-5H3 |
| InChIKey | YNWIDUWKIPKLTM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|