C20H24N2O2S — CID 70335181
ethyl 3-(4-tert-butylphenyl)-4-cyano-1-methyl-5-methylsulfanylpyrrole-2-carboxylate (PubChem CID 70335181) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is ethyl 3-(4-tert-butylphenyl)-4-cyano-1-methyl-5-methylsulfanylpyrrole-2-carboxylate.
| Compound Name | ethyl 3-(4-tert-butylphenyl)-4-cyano-1-methyl-5-methylsulfanylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 70335181 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | ethyl 3-(4-tert-butylphenyl)-4-cyano-1-methyl-5-methylsulfanylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C(C)(C)C)cc2)c(C#N)c(SC)n1C |
| InChI | InChI=1S/C20H24N2O2S/c1-7-24-19(23)17-16(15(12-21)18(25-6)22(17)5)13-8-10-14(11-9-13)20(2,3)4/h8-11H,7H2,1-6H3 |
| InChIKey | YITNGVLSXQSNIP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |