C23H21FN2O3 — CID 69020085
ethyl 4-cyano-5-ethyl-3-[4-(3-fluorophenoxy)phenyl]-1-methylpyrrole-2-carboxylate (PubChem CID 69020085) has the molecular formula C23H21FN2O3 and a molecular weight of 392.43 g/mol. Its IUPAC name is ethyl 4-cyano-5-ethyl-3-[4-(3-fluorophenoxy)phenyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-ethyl-3-[4-(3-fluorophenoxy)phenyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 69020085 |
| Molecular Formula | C23H21FN2O3 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | ethyl 4-cyano-5-ethyl-3-[4-(3-fluorophenoxy)phenyl]-1-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Oc3cccc(F)c3)cc2)c(C#N)c(CC)n1C |
| InChI | InChI=1S/C23H21FN2O3/c1-4-20-19(14-25)21(22(26(20)3)23(27)28-5-2)15-9-11-17(12-10-15)29-18-8-6-7-16(24)13-18/h6-13H,4-5H2,1-3H3 |
| InChIKey | HDKQHYNISJCCFQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |