C24H23FN2O2 — CID 69021036
ethyl 4-cyano-5-ethyl-3-[4-[(2-fluorophenyl)methyl]phenyl]-1-methylpyrrole-2-carboxylate (PubChem CID 69021036) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 4-cyano-5-ethyl-3-[4-[(2-fluorophenyl)methyl]phenyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-ethyl-3-[4-[(2-fluorophenyl)methyl]phenyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 69021036 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | ethyl 4-cyano-5-ethyl-3-[4-[(2-fluorophenyl)methyl]phenyl]-1-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cc3ccccc3F)cc2)c(C#N)c(CC)n1C |
| InChI | InChI=1S/C24H23FN2O2/c1-4-21-19(15-26)22(23(27(21)3)24(28)29-5-2)17-12-10-16(11-13-17)14-18-8-6-7-9-20(18)25/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | LVUMNQPNRPDGES-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |