C28H21N3O2S — CID 69020941
ethyl 4-cyano-3-[4-(2-cyanophenyl)phenyl]-1-methyl-5-phenylsulfanylpyrrole-2-carboxylate (PubChem CID 69020941) has the molecular formula C28H21N3O2S and a molecular weight of 463.56 g/mol. Its IUPAC name is ethyl 4-cyano-3-[4-(2-cyanophenyl)phenyl]-1-methyl-5-phenylsulfanylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-[4-(2-cyanophenyl)phenyl]-1-methyl-5-phenylsulfanylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 69020941 |
| Molecular Formula | C28H21N3O2S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | ethyl 4-cyano-3-[4-(2-cyanophenyl)phenyl]-1-methyl-5-phenylsulfanylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(-c3ccccc3C#N)cc2)c(C#N)c(Sc2ccccc2)n1C |
| InChI | InChI=1S/C28H21N3O2S/c1-3-33-28(32)26-25(24(18-30)27(31(26)2)34-22-10-5-4-6-11-22)20-15-13-19(14-16-20)23-12-8-7-9-21(23)17-29/h4-16H,3H2,1-2H3 |
| InChIKey | WDPUUSVNLCYAQH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 78.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |