C60H54N2O10S2 — CID 139041880
ethyl 2,3,6-tris(4-methoxyphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 139041880) has the molecular formula C60H54N2O10S2 and a molecular weight of 1027.23 g/mol. Its IUPAC name is ethyl 2,3,6-tris(4-methoxyphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 2,3,6-tris(4-methoxyphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 139041880 |
| Molecular Formula | C60H54N2O10S2 |
| Molecular Weight | 1027.23 g/mol |
| Exact Mass | 1026.32 |
| IUPAC Name | ethyl 2,3,6-tris(4-methoxyphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)sc2c1-c1ccc(OC)cc1.CCOC(=O)c1[nH]c2c(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)sc2c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/2C30H27NO5S/c2*1-5-36-30(32)27-25(19-8-14-22(34-3)15-9-19)29-26(31-27)24(18-6-12-21(33-2)13-7-18)28(37-29)20-10-16-23(35-4)17-11-20/h2*6-17,31H,5H2,1-4H3 |
| InChIKey | ACQYWSVXSLYWSP-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.23 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |