C24H24BrClFN3OSi — CID 150802438
2-[[4-(3-bromoquinolin-6-yl)-5-(5-chloro-2-fluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 150802438) has the molecular formula C24H24BrClFN3OSi and a molecular weight of 532.92 g/mol. Its IUPAC name is 2-[[4-(3-bromoquinolin-6-yl)-5-(5-chloro-2-fluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(3-bromoquinolin-6-yl)-5-(5-chloro-2-fluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 150802438 |
| Molecular Formula | C24H24BrClFN3OSi |
| Molecular Weight | 532.92 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 2-[[4-(3-bromoquinolin-6-yl)-5-(5-chloro-2-fluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc(-c2ccc3ncc(Br)cc3c2)c1-c1cc(Cl)ccc1F |
| InChI | InChI=1S/C24H24BrClFN3OSi/c1-32(2,3)9-8-31-15-30-14-29-23(24(30)20-12-19(26)5-6-21(20)27)16-4-7-22-17(10-16)11-18(25)13-28-22/h4-7,10-14H,8-9,15H2,1-3H3 |
| InChIKey | KGDPWTPSOLXXFG-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.92 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|