C22H24ClFN4O2Si — CID 175826959
5-[5-(5-chloro-2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1,3-benzoxazol-2-amine (PubChem CID 175826959) has the molecular formula C22H24ClFN4O2Si and a molecular weight of 459.00 g/mol. Its IUPAC name is 5-[5-(5-chloro-2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1,3-benzoxazol-2-amine.
| Compound Name | 5-[5-(5-chloro-2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 175826959 |
| Molecular Formula | C22H24ClFN4O2Si |
| Molecular Weight | 459.00 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 5-[5-(5-chloro-2-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-1,3-benzoxazol-2-amine |
| SMILES | C[Si](C)(C)CCOCn1cnc(-c2ccc3oc(N)nc3c2)c1-c1cc(Cl)ccc1F |
| InChI | InChI=1S/C22H24ClFN4O2Si/c1-31(2,3)9-8-29-13-28-12-26-20(21(28)16-11-15(23)5-6-17(16)24)14-4-7-19-18(10-14)27-22(25)30-19/h4-7,10-12H,8-9,13H2,1-3H3,(H2,25,27) |
| InChIKey | WVQYKYDSCPXCPC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.00 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|