About 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one
6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 70798738) has the molecular formula C18H16N4O3
and a molecular weight of 336.35 g/mol. Its IUPAC name is 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one |
| PubChem CID | 70798738 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | COCCn1cnc2ccc(-c3ccc4oc(N)nc4c3)cc2c1=O |
| InChI | InChI=1S/C18H16N4O3/c1-24-7-6-22-10-20-14-4-2-11(8-13(14)17(22)23)12-3-5-16-15(9-12)21-18(19)25-16/h2-5,8-10H,6-7H2,1H3,(H2,19,21) |
| InChIKey | PHNKZDOYRKDKRZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one?
The IUPAC name of 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one (CID 70798738) is 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one.
What is the SMILES notation for 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one?
The canonical SMILES for 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one is COCCn1cnc2ccc(-c3ccc4oc(N)nc4c3)cc2c1=O.
What is the InChIKey of 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one?
The InChIKey is PHNKZDOYRKDKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O3/c1-24-7-6-22-10-20-14-4-2-11(8-13(14)17(22)23)12-3-5-16-15(9-12)21-18(19)25-16/h2-5,8-10H,6-7H2,1H3,(H2,19,21).
What are the key properties of 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one?
6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one has a molecular weight of 336.35 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-amino-1,3-benzoxazol-5-yl)-3-(2-methoxyethyl)quinazolin-4-one is sourced from PubChem (CID 70798738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).