C28H29ClN6O4Si — CID 174071101
2-[(7-chloro-10,17,20-trioxa-4,6,8,14,23,29-hexazahexacyclo[19.5.3.12,5.112,16.024,28.09,31]hentriaconta-1(27),2,5(31),6,8,12(30),13,15,21,23,25,28-dodecaen-4-yl)methoxy]ethyl-trimethylsilane (PubChem CID 174071101) has the molecular formula C28H29ClN6O4Si and a molecular weight of 577.12 g/mol. Its IUPAC name is 2-[(7-chloro-10,17,20-trioxa-4,6,8,14,23,29-hexazahexacyclo[19.5.3.12,5.112,16.024,28.09,31]hentriaconta-1(27),2,5(31),6,8,12(30),13,15,21,23,25,28-dodecaen-4-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(7-chloro-10,17,20-trioxa-4,6,8,14,23,29-hexazahexacyclo[19.5.3.12,5.112,16.024,28.09,31]hentriaconta-1(27),2,5(31),6,8,12(30),13,15,21,23,25,28-dodecaen-4-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174071101 |
| Molecular Formula | C28H29ClN6O4Si |
| Molecular Weight | 577.12 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 2-[(7-chloro-10,17,20-trioxa-4,6,8,14,23,29-hexazahexacyclo[19.5.3.12,5.112,16.024,28.09,31]hentriaconta-1(27),2,5(31),6,8,12(30),13,15,21,23,25,28-dodecaen-4-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc2c3c(nc(Cl)nc31)OCc1cncc(c1)OCCOc1cnc3ccc-2cc3n1 |
| InChI | InChI=1S/C28H29ClN6O4Si/c1-40(2,3)9-8-36-17-35-15-21-19-4-5-22-23(11-19)32-24(14-31-22)38-7-6-37-20-10-18(12-30-13-20)16-39-27-25(21)26(35)33-28(29)34-27/h4-5,10-15H,6-9,16-17H2,1-3H3 |
| InChIKey | UNGLTKKLJOQHOZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.12 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|