C19H22BrFN2O2Si — CID 90117077
2-[[4-(4-bromo-3-fluorophenoxy)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 90117077) has the molecular formula C19H22BrFN2O2Si and a molecular weight of 437.39 g/mol. Its IUPAC name is 2-[[4-(4-bromo-3-fluorophenoxy)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(4-bromo-3-fluorophenoxy)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90117077 |
| Molecular Formula | C19H22BrFN2O2Si |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2-[[4-(4-bromo-3-fluorophenoxy)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Oc3ccc(Br)c(F)c3)nccc21 |
| InChI | InChI=1S/C19H22BrFN2O2Si/c1-26(2,3)11-10-24-13-23-9-7-15-18(23)6-8-22-19(15)25-14-4-5-16(20)17(21)12-14/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | CVAYFBPPGPVVPQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|