C20H23BrClF3N4OSi — CID 67053559
2-[[4-bromo-5-(2-chloro-1,4-dihydropyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67053559) has the molecular formula C20H23BrClF3N4OSi and a molecular weight of 535.87 g/mol. Its IUPAC name is 2-[[4-bromo-5-(2-chloro-1,4-dihydropyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-bromo-5-(2-chloro-1,4-dihydropyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67053559 |
| Molecular Formula | C20H23BrClF3N4OSi |
| Molecular Weight | 535.87 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | 2-[[4-bromo-5-(2-chloro-1,4-dihydropyrimidin-4-yl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(C(F)(F)F)cc2)nc(Br)c1C1C=CNC(Cl)=N1 |
| InChI | InChI=1S/C20H23BrClF3N4OSi/c1-31(2,3)11-10-30-12-29-16(15-8-9-26-19(22)27-15)17(21)28-18(29)13-4-6-14(7-5-13)20(23,24)25/h4-9,15H,10-12H2,1-3H3,(H,26,27) |
| InChIKey | IGBXAWVFNNXCEG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.87 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|