C18H26ClN5O4 — CID 174585916
5-(2-chloro-4-nitrophenoxy)-2,3-dihydro-1H-isoindole-1-carbaldehyde;methanamine (PubChem CID 174585916) has the molecular formula C18H26ClN5O4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenoxy)-2,3-dihydro-1H-isoindole-1-carbaldehyde;methanamine.
| Compound Name | 5-(2-chloro-4-nitrophenoxy)-2,3-dihydro-1H-isoindole-1-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 174585916 |
| Molecular Formula | C18H26ClN5O4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 5-(2-chloro-4-nitrophenoxy)-2,3-dihydro-1H-isoindole-1-carbaldehyde;methanamine |
| SMILES | CN.CN.CN.O=CC1NCc2cc(Oc3ccc([N+](=O)[O-])cc3Cl)ccc21 |
| InChI | InChI=1S/C15H11ClN2O4.3CH5N/c16-13-6-10(18(20)21)1-4-15(13)22-11-2-3-12-9(5-11)7-17-14(12)8-19;3*1-2/h1-6,8,14,17H,7H2;3*2H2,1H3 |
| InChIKey | HDGNCQLTERVQHX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 159.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|