C17H18ClNO5S — CID 68670659
2-chloro-1-[3-(2,2-dimethylpropylsulfonyl)phenoxy]-4-nitrobenzene (PubChem CID 68670659) has the molecular formula C17H18ClNO5S and a molecular weight of 383.85 g/mol. Its IUPAC name is 2-chloro-1-[3-(2,2-dimethylpropylsulfonyl)phenoxy]-4-nitrobenzene.
| Compound Name | 2-chloro-1-[3-(2,2-dimethylpropylsulfonyl)phenoxy]-4-nitrobenzene |
|---|---|
| PubChem CID | 68670659 |
| Molecular Formula | C17H18ClNO5S |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-chloro-1-[3-(2,2-dimethylpropylsulfonyl)phenoxy]-4-nitrobenzene |
| SMILES | CC(C)(C)CS(=O)(=O)c1cccc(Oc2ccc([N+](=O)[O-])cc2Cl)c1 |
| InChI | InChI=1S/C17H18ClNO5S/c1-17(2,3)11-25(22,23)14-6-4-5-13(10-14)24-16-8-7-12(19(20)21)9-15(16)18/h4-10H,11H2,1-3H3 |
| InChIKey | DOWAGCPHPUXYOY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|