C23H33ClN2O3Si — CID 70249923
tert-butyl-[[2-(chloromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]-(2,5-dimethoxyphenyl)methoxy]-dimethylsilane (PubChem CID 70249923) has the molecular formula C23H33ClN2O3Si and a molecular weight of 449.07 g/mol. Its IUPAC name is tert-butyl-[[2-(chloromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]-(2,5-dimethoxyphenyl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[2-(chloromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]-(2,5-dimethoxyphenyl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 70249923 |
| Molecular Formula | C23H33ClN2O3Si |
| Molecular Weight | 449.07 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | tert-butyl-[[2-(chloromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-3-yl]-(2,5-dimethoxyphenyl)methoxy]-dimethylsilane |
| SMILES | COc1ccc(OC)c(C(O[Si](C)(C)C(C)(C)C)C2C(CCl)N=C3C=CC=CN32)c1 |
| InChI | InChI=1S/C23H33ClN2O3Si/c1-23(2,3)30(6,7)29-22(17-14-16(27-4)11-12-19(17)28-5)21-18(15-24)25-20-10-8-9-13-26(20)21/h8-14,18,21-22H,15H2,1-7H3 |
| InChIKey | ODSRFPWOGODDIK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|